C6H5Cl3S — CID 174951805
sulfane;1,3,5-trichlorobenzene (PubChem CID 174951805) has the molecular formula C6H5Cl3S and a molecular weight of 215.53 g/mol. Its IUPAC name is sulfane;1,3,5-trichlorobenzene.
| Compound Name | sulfane;1,3,5-trichlorobenzene |
|---|---|
| PubChem CID | 174951805 |
| Molecular Formula | C6H5Cl3S |
| Molecular Weight | 215.53 g/mol |
| Exact Mass | 213.92 |
| IUPAC Name | sulfane;1,3,5-trichlorobenzene |
| SMILES | Clc1cc(Cl)cc(Cl)c1.S |
| InChI | InChI=1S/C6H3Cl3.H2S/c7-4-1-5(8)3-6(9)2-4;/h1-3H;1H2 |
| InChIKey | KGIKCQKYJGGTPX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |