About sulfane;1,3,5-trichlorobenzene
sulfane;1,3,5-trichlorobenzene (PubChem CID 174951805) has the molecular formula C6H5Cl3S
and a molecular weight of 215.53 g/mol. Its IUPAC name is sulfane;1,3,5-trichlorobenzene.
Molecular Properties
| Compound Name | sulfane;1,3,5-trichlorobenzene |
| PubChem CID | 174951805 |
| Molecular Formula | C6H5Cl3S |
| Molecular Weight | 215.53 g/mol |
| Exact Mass | 213.92 |
| IUPAC Name | sulfane;1,3,5-trichlorobenzene |
| SMILES | Clc1cc(Cl)cc(Cl)c1.S |
| InChI | InChI=1S/C6H3Cl3.H2S/c7-4-1-5(8)3-6(9)2-4;/h1-3H;1H2 |
| InChIKey | KGIKCQKYJGGTPX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze sulfane;1,3,5-trichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfane;1,3,5-trichlorobenzene?
The IUPAC name of sulfane;1,3,5-trichlorobenzene (CID 174951805) is sulfane;1,3,5-trichlorobenzene.
What is the SMILES notation for sulfane;1,3,5-trichlorobenzene?
The canonical SMILES for sulfane;1,3,5-trichlorobenzene is Clc1cc(Cl)cc(Cl)c1.S.
What is the InChIKey of sulfane;1,3,5-trichlorobenzene?
The InChIKey is KGIKCQKYJGGTPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl3.H2S/c7-4-1-5(8)3-6(9)2-4;/h1-3H;1H2.
What are the key properties of sulfane;1,3,5-trichlorobenzene?
sulfane;1,3,5-trichlorobenzene has a molecular weight of 215.53 g/mol, XLogP of 3.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sulfane;1,3,5-trichlorobenzene is sourced from PubChem (CID 174951805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).