C7H4Cl4 — CID 19898502
1,3-dichloro-5-(dichloromethyl)benzene (PubChem CID 19898502) has the molecular formula C7H4Cl4 and a molecular weight of 229.92 g/mol. Its IUPAC name is 1,3-dichloro-5-(dichloromethyl)benzene.
| Compound Name | 1,3-dichloro-5-(dichloromethyl)benzene |
|---|---|
| PubChem CID | 19898502 |
| Molecular Formula | C7H4Cl4 |
| Molecular Weight | 229.92 g/mol |
| Exact Mass | 227.91 |
| IUPAC Name | 1,3-dichloro-5-(dichloromethyl)benzene |
| SMILES | Clc1cc(Cl)cc(C(Cl)Cl)c1 |
| InChI | InChI=1S/C7H4Cl4/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,7H |
| InChIKey | YARYAWIHMVXQQY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.92 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|