About 1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine
1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine (PubChem CID 55296697) has the molecular formula C7H6F4N2
and a molecular weight of 194.13 g/mol. Its IUPAC name is 1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine.
Molecular Properties
| Compound Name | 1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine |
| PubChem CID | 55296697 |
| Molecular Formula | C7H6F4N2 |
| Molecular Weight | 194.13 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine |
| SMILES | CC(N)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C7H6F4N2/c1-2(12)3-4(8)6(10)13-7(11)5(3)9/h2H,12H2,1H3 |
| InChIKey | LEXBKVLIOAVBQQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.13 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine?
The IUPAC name of 1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine (CID 55296697) is 1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine.
What is the SMILES notation for 1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine?
The canonical SMILES for 1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine is CC(N)c1c(F)c(F)nc(F)c1F.
What is the InChIKey of 1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine?
The InChIKey is LEXBKVLIOAVBQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F4N2/c1-2(12)3-4(8)6(10)13-7(11)5(3)9/h2H,12H2,1H3.
What are the key properties of 1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine?
1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine has a molecular weight of 194.13 g/mol, XLogP of 1.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine is sourced from PubChem (CID 55296697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).