C8H6ClF4N — CID 117110993
1-(4-chloro-2,3,5,6-tetrafluorophenyl)ethanamine (PubChem CID 117110993) has the molecular formula C8H6ClF4N and a molecular weight of 227.59 g/mol. Its IUPAC name is 1-(4-chloro-2,3,5,6-tetrafluorophenyl)ethanamine.
| Compound Name | 1-(4-chloro-2,3,5,6-tetrafluorophenyl)ethanamine |
|---|---|
| PubChem CID | 117110993 |
| Molecular Formula | C8H6ClF4N |
| Molecular Weight | 227.59 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | 1-(4-chloro-2,3,5,6-tetrafluorophenyl)ethanamine |
| SMILES | CC(N)c1c(F)c(F)c(Cl)c(F)c1F |
| InChI | InChI=1S/C8H6ClF4N/c1-2(14)3-5(10)7(12)4(9)8(13)6(3)11/h2H,14H2,1H3 |
| InChIKey | RBTWTOVMHWMRSI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|