C9H8ClF4N — CID 115113261
2-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine (PubChem CID 115113261) has the molecular formula C9H8ClF4N and a molecular weight of 241.62 g/mol. Its IUPAC name is 2-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine.
| Compound Name | 2-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 115113261 |
| Molecular Formula | C9H8ClF4N |
| Molecular Weight | 241.62 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 2-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine |
| SMILES | CC(CN)c1c(F)c(F)c(Cl)c(F)c1F |
| InChI | InChI=1S/C9H8ClF4N/c1-3(2-15)4-6(11)8(13)5(10)9(14)7(4)12/h3H,2,15H2,1H3 |
| InChIKey | LPRSJHSXBVDDCM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.62 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|