C8H5Cl2F4NO — CID 154268087
N,N-dichloro-4-ethoxy-2,3,5,6-tetrafluoroaniline (PubChem CID 154268087) has the molecular formula C8H5Cl2F4NO and a molecular weight of 278.03 g/mol. Its IUPAC name is N,N-dichloro-4-ethoxy-2,3,5,6-tetrafluoroaniline.
| Compound Name | N,N-dichloro-4-ethoxy-2,3,5,6-tetrafluoroaniline |
|---|---|
| PubChem CID | 154268087 |
| Molecular Formula | C8H5Cl2F4NO |
| Molecular Weight | 278.03 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | N,N-dichloro-4-ethoxy-2,3,5,6-tetrafluoroaniline |
| SMILES | CCOc1c(F)c(F)c(N(Cl)Cl)c(F)c1F |
| InChI | InChI=1S/C8H5Cl2F4NO/c1-2-16-8-5(13)3(11)7(15(9)10)4(12)6(8)14/h2H2,1H3 |
| InChIKey | FTADHYSRGXMGOO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.03 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|