C22H22N4O6-2 — CID 163152070
(1S,2R,3R,4S)-2-N,3-N-bis[3-[hydroxy(oxido)amino]phenyl]bicyclo[2.2.2]oct-5-ene-2,3-dicarboxamide (PubChem CID 163152070) has the molecular formula C22H22N4O6-2 and a molecular weight of 438.44 g/mol. Its IUPAC name is (1S,2R,3R,4S)-2-N,3-N-bis[3-[hydroxy(oxido)amino]phenyl]bicyclo[2.2.2]oct-5-ene-2,3-dicarboxamide.
| Compound Name | (1S,2R,3R,4S)-2-N,3-N-bis[3-[hydroxy(oxido)amino]phenyl]bicyclo[2.2.2]oct-5-ene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 163152070 |
| Molecular Formula | C22H22N4O6-2 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (1S,2R,3R,4S)-2-N,3-N-bis[3-[hydroxy(oxido)amino]phenyl]bicyclo[2.2.2]oct-5-ene-2,3-dicarboxamide |
| SMILES | O=C(Nc1cccc(N([O-])O)c1)[C@H]1[C@H](C(=O)Nc2cccc(N([O-])O)c2)[C@@H]2C=C[C@@H]1CC2 |
| InChI | InChI=1S/C22H22N4O6/c27-21(23-15-3-1-5-17(11-15)25(29)30)19-13-7-9-14(10-8-13)20(19)22(28)24-16-4-2-6-18(12-16)26(31)32/h1-7,9,11-14,19-20,29,31H,8,10H2,(H,23,27)(H,24,28)/q-2/t13-,14-,19-,20-/m1/s1 |
| InChIKey | VKNMMKMPJFTWHI-UYVJDWJCSA-N |
| XLogP | 3.48 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|