C10H7F6N2O3- — CID 163164985
3,3,3-trifluoro-N-[3-[hydroxy(oxido)amino]phenyl]-2-(trifluoromethyl)propanamide (PubChem CID 163164985) has the molecular formula C10H7F6N2O3- and a molecular weight of 317.17 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[3-[hydroxy(oxido)amino]phenyl]-2-(trifluoromethyl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-[3-[hydroxy(oxido)amino]phenyl]-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 163164985 |
| Molecular Formula | C10H7F6N2O3- |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 3,3,3-trifluoro-N-[3-[hydroxy(oxido)amino]phenyl]-2-(trifluoromethyl)propanamide |
| SMILES | O=C(Nc1cccc(N([O-])O)c1)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H7F6N2O3/c11-9(12,13)7(10(14,15)16)8(19)17-5-2-1-3-6(4-5)18(20)21/h1-4,7,20H,(H,17,19)/q-1 |
| InChIKey | PVICISCTYBSYNI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|