C12H15N4O5- — CID 20844014
methyl N-[(E)-[4-[3-[hydroxy(oxido)amino]anilino]-4-oxobutan-2-ylidene]amino]carbamate (PubChem CID 20844014) has the molecular formula C12H15N4O5- and a molecular weight of 295.28 g/mol. Its IUPAC name is methyl N-[(E)-[4-[3-[hydroxy(oxido)amino]anilino]-4-oxobutan-2-ylidene]amino]carbamate.
| Compound Name | methyl N-[(E)-[4-[3-[hydroxy(oxido)amino]anilino]-4-oxobutan-2-ylidene]amino]carbamate |
|---|---|
| PubChem CID | 20844014 |
| Molecular Formula | C12H15N4O5- |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | methyl N-[(E)-[4-[3-[hydroxy(oxido)amino]anilino]-4-oxobutan-2-ylidene]amino]carbamate |
| SMILES | COC(=O)N/N=C(\C)CC(=O)Nc1cccc(N([O-])O)c1 |
| InChI | InChI=1S/C12H15N4O5/c1-8(14-15-12(18)21-2)6-11(17)13-9-4-3-5-10(7-9)16(19)20/h3-5,7,19H,6H2,1-2H3,(H,13,17)(H,15,18)/q-1/b14-8+ |
| InChIKey | ZYJQVVVOSFVHQU-RIYZIHGNSA-N |
| XLogP | 1.44 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|