C12H13N2O3- — CID 163137695
3-[3-[hydroxy(oxido)amino]anilino]cyclohex-2-en-1-one (PubChem CID 163137695) has the molecular formula C12H13N2O3- and a molecular weight of 233.25 g/mol. Its IUPAC name is 3-[3-[hydroxy(oxido)amino]anilino]cyclohex-2-en-1-one.
| Compound Name | 3-[3-[hydroxy(oxido)amino]anilino]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 163137695 |
| Molecular Formula | C12H13N2O3- |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 3-[3-[hydroxy(oxido)amino]anilino]cyclohex-2-en-1-one |
| SMILES | O=C1C=C(Nc2cccc(N([O-])O)c2)CCC1 |
| InChI | InChI=1S/C12H13N2O3/c15-12-6-2-4-10(8-12)13-9-3-1-5-11(7-9)14(16)17/h1,3,5,7-8,13,16H,2,4,6H2/q-1 |
| InChIKey | YCURQYNKXLEIJC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|