C29H42N2O — CID 171576970
N-[3-(dicyclohexylamino)phenyl]adamantane-1-carboxamide (PubChem CID 171576970) has the molecular formula C29H42N2O and a molecular weight of 434.67 g/mol. Its IUPAC name is N-[3-(dicyclohexylamino)phenyl]adamantane-1-carboxamide.
| Compound Name | N-[3-(dicyclohexylamino)phenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 171576970 |
| Molecular Formula | C29H42N2O |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.33 |
| IUPAC Name | N-[3-(dicyclohexylamino)phenyl]adamantane-1-carboxamide |
| SMILES | O=C(Nc1cccc(N(C2CCCCC2)C2CCCCC2)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C29H42N2O/c32-28(29-18-21-14-22(19-29)16-23(15-21)20-29)30-24-8-7-13-27(17-24)31(25-9-3-1-4-10-25)26-11-5-2-6-12-26/h7-8,13,17,21-23,25-26H,1-6,9-12,14-16,18-20H2,(H,30,32) |
| InChIKey | RHBQVPHMQGXFOD-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |