C24H34N2O2 — CID 141094117
N-[3-[cyclohexyl(cyclopentanecarbonyl)amino]phenyl]cyclopentanecarboxamide (PubChem CID 141094117) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is N-[3-[cyclohexyl(cyclopentanecarbonyl)amino]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[3-[cyclohexyl(cyclopentanecarbonyl)amino]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 141094117 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | N-[3-[cyclohexyl(cyclopentanecarbonyl)amino]phenyl]cyclopentanecarboxamide |
| SMILES | O=C(Nc1cccc(N(C(=O)C2CCCC2)C2CCCCC2)c1)C1CCCC1 |
| InChI | InChI=1S/C24H34N2O2/c27-23(18-9-4-5-10-18)25-20-13-8-16-22(17-20)26(21-14-2-1-3-15-21)24(28)19-11-6-7-12-19/h8,13,16-19,21H,1-7,9-12,14-15H2,(H,25,27) |
| InChIKey | GTIAGOFYWFBPGO-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |