C21H28N2O4 — CID 120551532
3-[[3-(cyclohexanecarbonylamino)phenyl]carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 120551532) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 3-[[3-(cyclohexanecarbonylamino)phenyl]carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[[3-(cyclohexanecarbonylamino)phenyl]carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120551532 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 3-[[3-(cyclohexanecarbonylamino)phenyl]carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC(C(=O)Nc2cccc(NC(=O)C3CCCCC3)c2)C1 |
| InChI | InChI=1S/C21H28N2O4/c24-19(14-6-2-1-3-7-14)22-17-10-5-11-18(13-17)23-20(25)15-8-4-9-16(12-15)21(26)27/h5,10-11,13-16H,1-4,6-9,12H2,(H,22,24)(H,23,25)(H,26,27) |
| InChIKey | WDAXLBRESSSZLQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |