C14H15F2NO3 — CID 63783799
3-[(3,5-difluorophenyl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 63783799) has the molecular formula C14H15F2NO3 and a molecular weight of 283.27 g/mol. Its IUPAC name is 3-[(3,5-difluorophenyl)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[(3,5-difluorophenyl)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63783799 |
| Molecular Formula | C14H15F2NO3 |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-[(3,5-difluorophenyl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC(C(=O)Nc2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C14H15F2NO3/c15-10-5-11(16)7-12(6-10)17-13(18)8-2-1-3-9(4-8)14(19)20/h5-9H,1-4H2,(H,17,18)(H,19,20) |
| InChIKey | DDEOGYJHFRLZBX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |