C29H36N2O2 — CID 118063091
N-[3-[3-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]adamantane-1-carboxamide (PubChem CID 118063091) has the molecular formula C29H36N2O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is N-[3-[3-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]adamantane-1-carboxamide.
| Compound Name | N-[3-[3-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 118063091 |
| Molecular Formula | C29H36N2O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | N-[3-[3-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]adamantane-1-carboxamide |
| SMILES | CN1CCC(Oc2cccc(-c3cccc(NC(=O)C45CC6CC(CC(C6)C4)C5)c3)c2)CC1 |
| InChI | InChI=1S/C29H36N2O2/c1-31-10-8-26(9-11-31)33-27-7-3-5-24(16-27)23-4-2-6-25(15-23)30-28(32)29-17-20-12-21(18-29)14-22(13-20)19-29/h2-7,15-16,20-22,26H,8-14,17-19H2,1H3,(H,30,32) |
| InChIKey | OUTLGHUCEYTXBX-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |