C25H28N2O2 — CID 144842995
(2E)-2-ethenyl-N-[3-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]penta-2,4-dienamide (PubChem CID 144842995) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is (2E)-2-ethenyl-N-[3-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]penta-2,4-dienamide.
| Compound Name | (2E)-2-ethenyl-N-[3-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 144842995 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (2E)-2-ethenyl-N-[3-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]penta-2,4-dienamide |
| SMILES | C=C/C=C(\C=C)C(=O)Nc1cccc(-c2ccc(OC3CCN(C)CC3)cc2)c1 |
| InChI | InChI=1S/C25H28N2O2/c1-4-7-19(5-2)25(28)26-22-9-6-8-21(18-22)20-10-12-23(13-11-20)29-24-14-16-27(3)17-15-24/h4-13,18,24H,1-2,14-17H2,3H3,(H,26,28)/b19-7+ |
| InChIKey | LWIRAFDBBZWKGU-FBCYGCLPSA-N |
| XLogP | 5.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|