C41H44N2O3 — CID 167167843
N-[3-(2,6-dimethylphenyl)phenyl]-4-[(2E,4E)-5-[[4-(1-methylpiperidin-4-yl)oxyphenyl]methoxy]hepta-2,4,6-trien-2-yl]benzamide (PubChem CID 167167843) has the molecular formula C41H44N2O3 and a molecular weight of 612.81 g/mol. Its IUPAC name is N-[3-(2,6-dimethylphenyl)phenyl]-4-[(2E,4E)-5-[[4-(1-methylpiperidin-4-yl)oxyphenyl]methoxy]hepta-2,4,6-trien-2-yl]benzamide.
| Compound Name | N-[3-(2,6-dimethylphenyl)phenyl]-4-[(2E,4E)-5-[[4-(1-methylpiperidin-4-yl)oxyphenyl]methoxy]hepta-2,4,6-trien-2-yl]benzamide |
|---|---|
| PubChem CID | 167167843 |
| Molecular Formula | C41H44N2O3 |
| Molecular Weight | 612.81 g/mol |
| Exact Mass | 612.34 |
| IUPAC Name | N-[3-(2,6-dimethylphenyl)phenyl]-4-[(2E,4E)-5-[[4-(1-methylpiperidin-4-yl)oxyphenyl]methoxy]hepta-2,4,6-trien-2-yl]benzamide |
| SMILES | C=C/C(=C\C=C(/C)c1ccc(C(=O)Nc2cccc(-c3c(C)cccc3C)c2)cc1)OCc1ccc(OC2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C41H44N2O3/c1-6-37(45-28-32-14-21-38(22-15-32)46-39-23-25-43(5)26-24-39)20-13-29(2)33-16-18-34(19-17-33)41(44)42-36-12-8-11-35(27-36)40-30(3)9-7-10-31(40)4/h6-22,27,39H,1,23-26,28H2,2-5H3,(H,42,44)/b29-13+,37-20+ |
| InChIKey | NWNSJXVIQKCTPX-GKSQOMDOSA-N |
| XLogP | 9.39 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.81 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|