C30H31N3O5 — CID 118064397
1-[3-(3-methoxyphenyl)phenyl]-3-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]urea (PubChem CID 118064397) has the molecular formula C30H31N3O5 and a molecular weight of 513.59 g/mol. Its IUPAC name is 1-[3-(3-methoxyphenyl)phenyl]-3-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]urea.
| Compound Name | 1-[3-(3-methoxyphenyl)phenyl]-3-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]urea |
|---|---|
| PubChem CID | 118064397 |
| Molecular Formula | C30H31N3O5 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 1-[3-(3-methoxyphenyl)phenyl]-3-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]urea |
| SMILES | COc1cccc(-c2cccc(NC(=O)Nc3cc4ccc(OC5CCN(C)CC5)c(C)c4oc3=O)c2)c1 |
| InChI | InChI=1S/C30H31N3O5/c1-19-27(37-24-12-14-33(2)15-13-24)11-10-22-18-26(29(34)38-28(19)22)32-30(35)31-23-8-4-6-20(16-23)21-7-5-9-25(17-21)36-3/h4-11,16-18,24H,12-15H2,1-3H3,(H2,31,32,35) |
| InChIKey | FIQOIHVQOBHRSE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|