C29H27NO8 — CID 53260253
N-[7-[(2S,3R)-3-hydroxyoxolan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide (PubChem CID 53260253) has the molecular formula C29H27NO8 and a molecular weight of 517.53 g/mol. Its IUPAC name is N-[7-[(2S,3R)-3-hydroxyoxolan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide.
| Compound Name | N-[7-[(2S,3R)-3-hydroxyoxolan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 53260253 |
| Molecular Formula | C29H27NO8 |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | N-[7-[(2S,3R)-3-hydroxyoxolan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3cc4ccc(O[C@@H]5OCC[C@H]5O)c(C)c4oc3=O)ccc2OC)c1 |
| InChI | InChI=1S/C29H27NO8/c1-16-24(37-29-23(31)11-12-36-29)9-7-18-15-22(28(33)38-26(16)18)30-27(32)19-8-10-25(35-3)21(14-19)17-5-4-6-20(13-17)34-2/h4-10,13-15,23,29,31H,11-12H2,1-3H3,(H,30,32)/t23-,29+/m1/s1 |
| InChIKey | KYFPKHJAUIGCAO-BTYSJIOQSA-N |
| XLogP | 4.52 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|