C32H30N2O7 — CID 53261368
N-[7-[(1-acetyl-3,6-dihydro-2H-pyridin-3-yl)oxy]-8-methyl-2-oxochromen-3-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide (PubChem CID 53261368) has the molecular formula C32H30N2O7 and a molecular weight of 554.60 g/mol. Its IUPAC name is N-[7-[(1-acetyl-3,6-dihydro-2H-pyridin-3-yl)oxy]-8-methyl-2-oxochromen-3-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide.
| Compound Name | N-[7-[(1-acetyl-3,6-dihydro-2H-pyridin-3-yl)oxy]-8-methyl-2-oxochromen-3-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 53261368 |
| Molecular Formula | C32H30N2O7 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | N-[7-[(1-acetyl-3,6-dihydro-2H-pyridin-3-yl)oxy]-8-methyl-2-oxochromen-3-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3cc4ccc(OC5C=CCN(C(C)=O)C5)c(C)c4oc3=O)ccc2OC)c1 |
| InChI | InChI=1S/C32H30N2O7/c1-19-28(40-25-9-6-14-34(18-25)20(2)35)12-10-22-17-27(32(37)41-30(19)22)33-31(36)23-11-13-29(39-4)26(16-23)21-7-5-8-24(15-21)38-3/h5-13,15-17,25H,14,18H2,1-4H3,(H,33,36) |
| InChIKey | JGWOPGFCABWZLM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|