C35H36N2O9 — CID 53261049
tert-butyl 3-[8-methoxy-3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-2-oxochromen-7-yl]oxy-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 53261049) has the molecular formula C35H36N2O9 and a molecular weight of 628.68 g/mol. Its IUPAC name is tert-butyl 3-[8-methoxy-3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-2-oxochromen-7-yl]oxy-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 3-[8-methoxy-3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-2-oxochromen-7-yl]oxy-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 53261049 |
| Molecular Formula | C35H36N2O9 |
| Molecular Weight | 628.68 g/mol |
| Exact Mass | 628.24 |
| IUPAC Name | tert-butyl 3-[8-methoxy-3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-2-oxochromen-7-yl]oxy-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3cc4ccc(OC5C=CCN(C(=O)OC(C)(C)C)C5)c(OC)c4oc3=O)ccc2OC)c1 |
| InChI | InChI=1S/C35H36N2O9/c1-35(2,3)46-34(40)37-16-8-11-25(20-37)44-29-15-12-22-19-27(33(39)45-30(22)31(29)43-6)36-32(38)23-13-14-28(42-5)26(18-23)21-9-7-10-24(17-21)41-4/h7-15,17-19,25H,16,20H2,1-6H3,(H,36,38) |
| InChIKey | BWODBLUQCOGGQC-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 125.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.68 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|