C31H32N2O6 — CID 53259596
4-methoxy-3-(3-methoxyphenyl)-N-[8-methyl-7-(1-methylpiperidin-3-yl)oxy-2-oxochromen-3-yl]benzamide (PubChem CID 53259596) has the molecular formula C31H32N2O6 and a molecular weight of 528.61 g/mol. Its IUPAC name is 4-methoxy-3-(3-methoxyphenyl)-N-[8-methyl-7-(1-methylpiperidin-3-yl)oxy-2-oxochromen-3-yl]benzamide.
| Compound Name | 4-methoxy-3-(3-methoxyphenyl)-N-[8-methyl-7-(1-methylpiperidin-3-yl)oxy-2-oxochromen-3-yl]benzamide |
|---|---|
| PubChem CID | 53259596 |
| Molecular Formula | C31H32N2O6 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 4-methoxy-3-(3-methoxyphenyl)-N-[8-methyl-7-(1-methylpiperidin-3-yl)oxy-2-oxochromen-3-yl]benzamide |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3cc4ccc(OC5CCCN(C)C5)c(C)c4oc3=O)ccc2OC)c1 |
| InChI | InChI=1S/C31H32N2O6/c1-19-27(38-24-9-6-14-33(2)18-24)12-10-21-17-26(31(35)39-29(19)21)32-30(34)22-11-13-28(37-4)25(16-22)20-7-5-8-23(15-20)36-3/h5,7-8,10-13,15-17,24H,6,9,14,18H2,1-4H3,(H,32,34) |
| InChIKey | JSMYFJXDBDPWRP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|