C30H30N4O7 — CID 102232210
1-[4-methoxy-3-(3-nitrophenyl)phenyl]-3-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]urea (PubChem CID 102232210) has the molecular formula C30H30N4O7 and a molecular weight of 558.59 g/mol. Its IUPAC name is 1-[4-methoxy-3-(3-nitrophenyl)phenyl]-3-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]urea.
| Compound Name | 1-[4-methoxy-3-(3-nitrophenyl)phenyl]-3-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]urea |
|---|---|
| PubChem CID | 102232210 |
| Molecular Formula | C30H30N4O7 |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | 1-[4-methoxy-3-(3-nitrophenyl)phenyl]-3-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]urea |
| SMILES | COc1ccc(NC(=O)Nc2cc3ccc(OC4CCN(C)CC4)c(C)c3oc2=O)cc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H30N4O7/c1-18-26(40-23-11-13-33(2)14-12-23)9-7-20-16-25(29(35)41-28(18)20)32-30(36)31-21-8-10-27(39-3)24(17-21)19-5-4-6-22(15-19)34(37)38/h4-10,15-17,23H,11-14H2,1-3H3,(H2,31,32,36) |
| InChIKey | CWNQGKLTGVWZDZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|