C24H26N2O5 — CID 53260576
benzyl N-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]carbamate (PubChem CID 53260576) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is benzyl N-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]carbamate.
| Compound Name | benzyl N-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]carbamate |
|---|---|
| PubChem CID | 53260576 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | benzyl N-[8-methyl-7-(1-methylpiperidin-4-yl)oxy-2-oxochromen-3-yl]carbamate |
| SMILES | Cc1c(OC2CCN(C)CC2)ccc2cc(NC(=O)OCc3ccccc3)c(=O)oc12 |
| InChI | InChI=1S/C24H26N2O5/c1-16-21(30-19-10-12-26(2)13-11-19)9-8-18-14-20(23(27)31-22(16)18)25-24(28)29-15-17-6-4-3-5-7-17/h3-9,14,19H,10-13,15H2,1-2H3,(H,25,28) |
| InChIKey | SUJILDAWRNQBLY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|