C22H24N2O5 — CID 87265987
benzyl N-[7-[2-(dimethylamino)ethoxy]-8-methyl-2-oxochromen-3-yl]carbamate (PubChem CID 87265987) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is benzyl N-[7-[2-(dimethylamino)ethoxy]-8-methyl-2-oxochromen-3-yl]carbamate.
| Compound Name | benzyl N-[7-[2-(dimethylamino)ethoxy]-8-methyl-2-oxochromen-3-yl]carbamate |
|---|---|
| PubChem CID | 87265987 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | benzyl N-[7-[2-(dimethylamino)ethoxy]-8-methyl-2-oxochromen-3-yl]carbamate |
| SMILES | Cc1c(OCCN(C)C)ccc2cc(NC(=O)OCc3ccccc3)c(=O)oc12 |
| InChI | InChI=1S/C22H24N2O5/c1-15-19(27-12-11-24(2)3)10-9-17-13-18(21(25)29-20(15)17)23-22(26)28-14-16-7-5-4-6-8-16/h4-10,13H,11-12,14H2,1-3H3,(H,23,26) |
| InChIKey | BQJADPOHNSSDCF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|