C21H19NO7 — CID 53261523
[6-methoxy-8-methyl-2-oxo-3-(phenylmethoxycarbonylamino)chromen-7-yl] acetate (PubChem CID 53261523) has the molecular formula C21H19NO7 and a molecular weight of 397.38 g/mol. Its IUPAC name is [6-methoxy-8-methyl-2-oxo-3-(phenylmethoxycarbonylamino)chromen-7-yl] acetate.
| Compound Name | [6-methoxy-8-methyl-2-oxo-3-(phenylmethoxycarbonylamino)chromen-7-yl] acetate |
|---|---|
| PubChem CID | 53261523 |
| Molecular Formula | C21H19NO7 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | [6-methoxy-8-methyl-2-oxo-3-(phenylmethoxycarbonylamino)chromen-7-yl] acetate |
| SMILES | COc1cc2cc(NC(=O)OCc3ccccc3)c(=O)oc2c(C)c1OC(C)=O |
| InChI | InChI=1S/C21H19NO7/c1-12-18-15(10-17(26-3)19(12)28-13(2)23)9-16(20(24)29-18)22-21(25)27-11-14-7-5-4-6-8-14/h4-10H,11H2,1-3H3,(H,22,25) |
| InChIKey | YRADKNQMKFZPQQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|