C26H29NO9 — CID 87265704
benzyl N-[7-[(2R,3S,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]carbamate (PubChem CID 87265704) has the molecular formula C26H29NO9 and a molecular weight of 499.52 g/mol. Its IUPAC name is benzyl N-[7-[(2R,3S,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]carbamate.
| Compound Name | benzyl N-[7-[(2R,3S,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]carbamate |
|---|---|
| PubChem CID | 87265704 |
| Molecular Formula | C26H29NO9 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | benzyl N-[7-[(2R,3S,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]carbamate |
| SMILES | CO[C@@H]1[C@@H](O)[C@H](O)[C@H](Oc2ccc3cc(NC(=O)OCc4ccccc4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C26H29NO9/c1-14-18(34-24-20(29)19(28)22(32-4)26(2,3)36-24)11-10-16-12-17(23(30)35-21(14)16)27-25(31)33-13-15-8-6-5-7-9-15/h5-12,19-20,22,24,28-29H,13H2,1-4H3,(H,27,31)/t19-,20-,22+,24+/m0/s1 |
| InChIKey | RLUREXJIIRABCO-CXFRRJOOSA-N |
| XLogP | 3.10 |
| TPSA | 136.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|