C26H27NO10 — CID 58214572
7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-3-[2-(4-nitrophenyl)-2-oxoethyl]chromen-2-one (PubChem CID 58214572) has the molecular formula C26H27NO10 and a molecular weight of 513.50 g/mol. Its IUPAC name is 7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-3-[2-(4-nitrophenyl)-2-oxoethyl]chromen-2-one.
| Compound Name | 7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-3-[2-(4-nitrophenyl)-2-oxoethyl]chromen-2-one |
|---|---|
| PubChem CID | 58214572 |
| Molecular Formula | C26H27NO10 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-3-[2-(4-nitrophenyl)-2-oxoethyl]chromen-2-one |
| SMILES | CO[C@@H]1[C@@H](O)[C@@H](O)[C@H](Oc2ccc3cc(CC(=O)c4ccc([N+](=O)[O-])cc4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C26H27NO10/c1-13-19(35-25-21(30)20(29)23(34-4)26(2,3)37-25)10-7-15-11-16(24(31)36-22(13)15)12-18(28)14-5-8-17(9-6-14)27(32)33/h5-11,20-21,23,25,29-30H,12H2,1-4H3/t20-,21+,23+,25+/m0/s1 |
| InChIKey | MVCXBUSYSOCYGH-KWLZBDKBSA-N |
| XLogP | 2.69 |
| TPSA | 158.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|