C25H28N2O8 — CID 74332938
2-amino-N-[7-(3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl)oxy-8-methyl-2-oxochromen-3-yl]benzamide (PubChem CID 74332938) has the molecular formula C25H28N2O8 and a molecular weight of 484.51 g/mol. Its IUPAC name is 2-amino-N-[7-(3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl)oxy-8-methyl-2-oxochromen-3-yl]benzamide.
| Compound Name | 2-amino-N-[7-(3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl)oxy-8-methyl-2-oxochromen-3-yl]benzamide |
|---|---|
| PubChem CID | 74332938 |
| Molecular Formula | C25H28N2O8 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 2-amino-N-[7-(3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl)oxy-8-methyl-2-oxochromen-3-yl]benzamide |
| SMILES | COC1C(O)C(O)C(Oc2ccc3cc(NC(=O)c4ccccc4N)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C25H28N2O8/c1-12-17(33-24-19(29)18(28)21(32-4)25(2,3)35-24)10-9-13-11-16(23(31)34-20(12)13)27-22(30)14-7-5-6-8-15(14)26/h5-11,18-19,21,24,28-29H,26H2,1-4H3,(H,27,30) |
| InChIKey | YRVOGHAJRKHBDX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 153.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|