C27H28N2O8 — CID 74317412
N-[7-(3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl)oxy-8-methyl-2-oxochromen-3-yl]-1H-indole-2-carboxamide (PubChem CID 74317412) has the molecular formula C27H28N2O8 and a molecular weight of 508.53 g/mol. Its IUPAC name is N-[7-(3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl)oxy-8-methyl-2-oxochromen-3-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[7-(3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl)oxy-8-methyl-2-oxochromen-3-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 74317412 |
| Molecular Formula | C27H28N2O8 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | N-[7-(3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl)oxy-8-methyl-2-oxochromen-3-yl]-1H-indole-2-carboxamide |
| SMILES | COC1C(O)C(O)C(Oc2ccc3cc(NC(=O)c4cc5ccccc5[nH]4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C27H28N2O8/c1-13-19(35-26-21(31)20(30)23(34-4)27(2,3)37-26)10-9-15-12-18(25(33)36-22(13)15)29-24(32)17-11-14-7-5-6-8-16(14)28-17/h5-12,20-21,23,26,28,30-31H,1-4H3,(H,29,32) |
| InChIKey | BOSOWCSQVIXMEF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 143.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|