C28H29N3O9 — CID 71770546
[(3R,4S,5R,6R)-5-hydroxy-6-[3-(1H-indole-2-carbonylamino)-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate (PubChem CID 71770546) has the molecular formula C28H29N3O9 and a molecular weight of 551.55 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-5-hydroxy-6-[3-(1H-indole-2-carbonylamino)-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate.
| Compound Name | [(3R,4S,5R,6R)-5-hydroxy-6-[3-(1H-indole-2-carbonylamino)-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
|---|---|
| PubChem CID | 71770546 |
| Molecular Formula | C28H29N3O9 |
| Molecular Weight | 551.55 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | [(3R,4S,5R,6R)-5-hydroxy-6-[3-(1H-indole-2-carbonylamino)-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
| SMILES | CO[C@@H]1[C@@H](OC(N)=O)[C@@H](O)[C@H](Oc2ccc3cc(NC(=O)c4cc5ccccc5[nH]4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C28H29N3O9/c1-13-19(37-26-20(32)22(39-27(29)35)23(36-4)28(2,3)40-26)10-9-15-12-18(25(34)38-21(13)15)31-24(33)17-11-14-7-5-6-8-16(14)30-17/h5-12,20,22-23,26,30,32H,1-4H3,(H2,29,35)(H,31,33)/t20-,22+,23-,26-/m1/s1 |
| InChIKey | AMSXLWIRWDTINI-PCEGQDSGSA-N |
| XLogP | 3.19 |
| TPSA | 175.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|