C28H29NO8 — CID 58214585
7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-3-[2-(1H-indol-3-yl)-2-oxoethyl]-8-methylchromen-2-one (PubChem CID 58214585) has the molecular formula C28H29NO8 and a molecular weight of 507.54 g/mol. Its IUPAC name is 7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-3-[2-(1H-indol-3-yl)-2-oxoethyl]-8-methylchromen-2-one.
| Compound Name | 7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-3-[2-(1H-indol-3-yl)-2-oxoethyl]-8-methylchromen-2-one |
|---|---|
| PubChem CID | 58214585 |
| Molecular Formula | C28H29NO8 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-3-[2-(1H-indol-3-yl)-2-oxoethyl]-8-methylchromen-2-one |
| SMILES | CO[C@@H]1[C@@H](O)[C@@H](O)[C@H](Oc2ccc3cc(CC(=O)c4c[nH]c5ccccc45)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C28H29NO8/c1-14-21(35-27-23(32)22(31)25(34-4)28(2,3)37-27)10-9-15-11-16(26(33)36-24(14)15)12-20(30)18-13-29-19-8-6-5-7-17(18)19/h5-11,13,22-23,25,27,29,31-32H,12H2,1-4H3/t22-,23+,25+,27+/m0/s1 |
| InChIKey | KXYVGEWLBXLMGI-CXQACEEJSA-N |
| XLogP | 3.26 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|