C28H39NO9 — CID 139935419
cis-(1S,3S)-N-[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-4-hydroxy-8-methyl-2-oxochromen-3-yl]-2,2-dimethyl-3-(2-methylpropyl)cyclopropane-1-carboxamide (PubChem CID 139935419) has the molecular formula C28H39NO9 and a molecular weight of 533.62 g/mol. Its IUPAC name is cis-(1S,3S)-N-[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-4-hydroxy-8-methyl-2-oxochromen-3-yl]-2,2-dimethyl-3-(2-methylpropyl)cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,3S)-N-[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-4-hydroxy-8-methyl-2-oxochromen-3-yl]-2,2-dimethyl-3-(2-methylpropyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 139935419 |
| Molecular Formula | C28H39NO9 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | cis-(1S,3S)-N-[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-4-hydroxy-8-methyl-2-oxochromen-3-yl]-2,2-dimethyl-3-(2-methylpropyl)cyclopropane-1-carboxamide |
| SMILES | CO[C@@H]1[C@@H](O)[C@@H](O)[C@H](Oc2ccc3c(O)c(NC(=O)[C@H]4[C@H](CC(C)C)C4(C)C)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C28H39NO9/c1-12(2)11-15-17(27(15,4)5)24(33)29-18-19(30)14-9-10-16(13(3)22(14)37-25(18)34)36-26-21(32)20(31)23(35-8)28(6,7)38-26/h9-10,12,15,17,20-21,23,26,30-32H,11H2,1-8H3,(H,29,33)/t15-,17+,20-,21+,23+,26+/m0/s1 |
| InChIKey | OICPWKZJBZKXLC-NIIUQPMNSA-N |
| XLogP | 3.31 |
| TPSA | 147.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|