C28H32O8 — CID 123359960
7-[(2S,4S,5R)-3,4-dihydroxy-5,6,6-trimethyloxan-2-yl]oxy-3-[2-(4-methoxy-3-methylphenyl)-2-oxoethyl]-8-methylchromen-2-one (PubChem CID 123359960) has the molecular formula C28H32O8 and a molecular weight of 496.56 g/mol. Its IUPAC name is 7-[(2S,4S,5R)-3,4-dihydroxy-5,6,6-trimethyloxan-2-yl]oxy-3-[2-(4-methoxy-3-methylphenyl)-2-oxoethyl]-8-methylchromen-2-one.
| Compound Name | 7-[(2S,4S,5R)-3,4-dihydroxy-5,6,6-trimethyloxan-2-yl]oxy-3-[2-(4-methoxy-3-methylphenyl)-2-oxoethyl]-8-methylchromen-2-one |
|---|---|
| PubChem CID | 123359960 |
| Molecular Formula | C28H32O8 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 7-[(2S,4S,5R)-3,4-dihydroxy-5,6,6-trimethyloxan-2-yl]oxy-3-[2-(4-methoxy-3-methylphenyl)-2-oxoethyl]-8-methylchromen-2-one |
| SMILES | COc1ccc(C(=O)Cc2cc3ccc(O[C@@H]4OC(C)(C)[C@H](C)[C@H](O)C4O)c(C)c3oc2=O)cc1C |
| InChI | InChI=1S/C28H32O8/c1-14-11-17(7-9-21(14)33-6)20(29)13-19-12-18-8-10-22(15(2)25(18)35-26(19)32)34-27-24(31)23(30)16(3)28(4,5)36-27/h7-12,16,23-24,27,30-31H,13H2,1-6H3/t16-,23+,24?,27-/m1/s1 |
| InChIKey | OOTZQBUSXARCQT-KWEWTABNSA-N |
| XLogP | 3.72 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|