C34H36O10 — CID 123221005
[4-[2-[7-[[(4S,7R,7aS)-6,6,7-trimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-8-methyl-2-oxochromen-3-yl]acetyl]-2-(3-methylbut-2-enyl)phenyl] acetate (PubChem CID 123221005) has the molecular formula C34H36O10 and a molecular weight of 604.65 g/mol. Its IUPAC name is [4-[2-[7-[[(4S,7R,7aS)-6,6,7-trimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-8-methyl-2-oxochromen-3-yl]acetyl]-2-(3-methylbut-2-enyl)phenyl] acetate.
| Compound Name | [4-[2-[7-[[(4S,7R,7aS)-6,6,7-trimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-8-methyl-2-oxochromen-3-yl]acetyl]-2-(3-methylbut-2-enyl)phenyl] acetate |
|---|---|
| PubChem CID | 123221005 |
| Molecular Formula | C34H36O10 |
| Molecular Weight | 604.65 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | [4-[2-[7-[[(4S,7R,7aS)-6,6,7-trimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-8-methyl-2-oxochromen-3-yl]acetyl]-2-(3-methylbut-2-enyl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)Cc2cc3ccc(O[C@@H]4OC(C)(C)[C@H](C)[C@@H]5OC(=O)OC45)c(C)c3oc2=O)cc1CC=C(C)C |
| InChI | InChI=1S/C34H36O10/c1-17(2)8-9-22-14-21(10-13-27(22)39-20(5)35)25(36)16-24-15-23-11-12-26(18(3)28(23)41-31(24)37)40-32-30-29(42-33(38)43-30)19(4)34(6,7)44-32/h8,10-15,19,29-30,32H,9,16H2,1-7H3/t19-,29+,30?,32-/m1/s1 |
| InChIKey | GMMMCYJPCCVMGY-TVLPRSCFSA-N |
| XLogP | 6.01 |
| TPSA | 127.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|