C31H38N2O4 — CID 159745930
8-methyl-3-[2-[4-methyl-3-(3-methylbut-2-enyl)phenyl]-2-oxoethyl]-7-(3-piperazin-1-ylpropoxy)chromen-2-one (PubChem CID 159745930) has the molecular formula C31H38N2O4 and a molecular weight of 502.66 g/mol. Its IUPAC name is 8-methyl-3-[2-[4-methyl-3-(3-methylbut-2-enyl)phenyl]-2-oxoethyl]-7-(3-piperazin-1-ylpropoxy)chromen-2-one.
| Compound Name | 8-methyl-3-[2-[4-methyl-3-(3-methylbut-2-enyl)phenyl]-2-oxoethyl]-7-(3-piperazin-1-ylpropoxy)chromen-2-one |
|---|---|
| PubChem CID | 159745930 |
| Molecular Formula | C31H38N2O4 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | 8-methyl-3-[2-[4-methyl-3-(3-methylbut-2-enyl)phenyl]-2-oxoethyl]-7-(3-piperazin-1-ylpropoxy)chromen-2-one |
| SMILES | CC(C)=CCc1cc(C(=O)Cc2cc3ccc(OCCCN4CCNCC4)c(C)c3oc2=O)ccc1C |
| InChI | InChI=1S/C31H38N2O4/c1-21(2)6-8-24-18-25(9-7-22(24)3)28(34)20-27-19-26-10-11-29(23(4)30(26)37-31(27)35)36-17-5-14-33-15-12-32-13-16-33/h6-7,9-11,18-19,32H,5,8,12-17,20H2,1-4H3 |
| InChIKey | KBNXZRBKUSEXAP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|