C31H40N2O5 — CID 144843283
4-hydroxy-3-(3-methylbut-2-enyl)benzaldehyde;8-methyl-3-(methylamino)-7-(3-piperidin-1-ylpropoxy)chromen-2-one (PubChem CID 144843283) has the molecular formula C31H40N2O5 and a molecular weight of 520.67 g/mol. Its IUPAC name is 4-hydroxy-3-(3-methylbut-2-enyl)benzaldehyde;8-methyl-3-(methylamino)-7-(3-piperidin-1-ylpropoxy)chromen-2-one.
| Compound Name | 4-hydroxy-3-(3-methylbut-2-enyl)benzaldehyde;8-methyl-3-(methylamino)-7-(3-piperidin-1-ylpropoxy)chromen-2-one |
|---|---|
| PubChem CID | 144843283 |
| Molecular Formula | C31H40N2O5 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | 4-hydroxy-3-(3-methylbut-2-enyl)benzaldehyde;8-methyl-3-(methylamino)-7-(3-piperidin-1-ylpropoxy)chromen-2-one |
| SMILES | CC(C)=CCc1cc(C=O)ccc1O.CNc1cc2ccc(OCCCN3CCCCC3)c(C)c2oc1=O |
| InChI | InChI=1S/C19H26N2O3.C12H14O2/c1-14-17(23-12-6-11-21-9-4-3-5-10-21)8-7-15-13-16(20-2)19(22)24-18(14)15;1-9(2)3-5-11-7-10(8-13)4-6-12(11)14/h7-8,13,20H,3-6,9-12H2,1-2H3;3-4,6-8,14H,5H2,1-2H3 |
| InChIKey | HDHMFSYDLPUGBE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|