C39H54N2O5 — CID 146429806
1-hydroxy-2,8-bis(3-methylbut-2-enyl)-3,6-bis(4-pyrrolidin-1-ylbutoxy)xanthen-9-one (PubChem CID 146429806) has the molecular formula C39H54N2O5 and a molecular weight of 630.87 g/mol. Its IUPAC name is 1-hydroxy-2,8-bis(3-methylbut-2-enyl)-3,6-bis(4-pyrrolidin-1-ylbutoxy)xanthen-9-one.
| Compound Name | 1-hydroxy-2,8-bis(3-methylbut-2-enyl)-3,6-bis(4-pyrrolidin-1-ylbutoxy)xanthen-9-one |
|---|---|
| PubChem CID | 146429806 |
| Molecular Formula | C39H54N2O5 |
| Molecular Weight | 630.87 g/mol |
| Exact Mass | 630.40 |
| IUPAC Name | 1-hydroxy-2,8-bis(3-methylbut-2-enyl)-3,6-bis(4-pyrrolidin-1-ylbutoxy)xanthen-9-one |
| SMILES | CC(C)=CCc1c(OCCCCN2CCCC2)cc2oc3cc(OCCCCN4CCCC4)cc(CC=C(C)C)c3c(=O)c2c1O |
| InChI | InChI=1S/C39H54N2O5/c1-28(2)13-15-30-25-31(44-23-11-9-21-40-17-5-6-18-40)26-34-36(30)39(43)37-35(46-34)27-33(32(38(37)42)16-14-29(3)4)45-24-12-10-22-41-19-7-8-20-41/h13-14,25-27,42H,5-12,15-24H2,1-4H3 |
| InChIKey | QUITYYAGMTVGLI-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.87 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|