C34H43NO6 — CID 155539572
5-hydroxy-8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-9-(6-pyrrolidin-1-ylhexoxy)pyrano[3,2-b]xanthen-6-one (PubChem CID 155539572) has the molecular formula C34H43NO6 and a molecular weight of 561.72 g/mol. Its IUPAC name is 5-hydroxy-8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-9-(6-pyrrolidin-1-ylhexoxy)pyrano[3,2-b]xanthen-6-one.
| Compound Name | 5-hydroxy-8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-9-(6-pyrrolidin-1-ylhexoxy)pyrano[3,2-b]xanthen-6-one |
|---|---|
| PubChem CID | 155539572 |
| Molecular Formula | C34H43NO6 |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | 5-hydroxy-8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-9-(6-pyrrolidin-1-ylhexoxy)pyrano[3,2-b]xanthen-6-one |
| SMILES | COc1c(OCCCCCCN2CCCC2)cc2oc3cc4c(c(O)c3c(=O)c2c1CC=C(C)C)C=CC(C)(C)O4 |
| InChI | InChI=1S/C34H43NO6/c1-22(2)12-13-24-29-26(21-28(33(24)38-5)39-19-11-7-6-8-16-35-17-9-10-18-35)40-27-20-25-23(14-15-34(3,4)41-25)31(36)30(27)32(29)37/h12,14-15,20-21,36H,6-11,13,16-19H2,1-5H3 |
| InChIKey | KOINQBSLUHJYRH-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 81.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|