C35H35FO8 — CID 164622755
4-[9-[(4-fluorophenyl)methoxy]-8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-6-oxopyrano[3,2-b]xanthen-5-yl]oxybutanoic acid (PubChem CID 164622755) has the molecular formula C35H35FO8 and a molecular weight of 602.66 g/mol. Its IUPAC name is 4-[9-[(4-fluorophenyl)methoxy]-8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-6-oxopyrano[3,2-b]xanthen-5-yl]oxybutanoic acid.
| Compound Name | 4-[9-[(4-fluorophenyl)methoxy]-8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-6-oxopyrano[3,2-b]xanthen-5-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 164622755 |
| Molecular Formula | C35H35FO8 |
| Molecular Weight | 602.66 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | 4-[9-[(4-fluorophenyl)methoxy]-8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-6-oxopyrano[3,2-b]xanthen-5-yl]oxybutanoic acid |
| SMILES | COc1c(OCc2ccc(F)cc2)cc2oc3cc4c(c(OCCCC(=O)O)c3c(=O)c2c1CC=C(C)C)C=CC(C)(C)O4 |
| InChI | InChI=1S/C35H35FO8/c1-20(2)8-13-24-30-26(18-28(33(24)40-5)42-19-21-9-11-22(36)12-10-21)43-27-17-25-23(14-15-35(3,4)44-25)34(31(27)32(30)39)41-16-6-7-29(37)38/h8-12,14-15,17-18H,6-7,13,16,19H2,1-5H3,(H,37,38) |
| InChIKey | XESGVNRXVFMDQD-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.66 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|