C38H40O10S — CID 162372084
ethyl (E)-4-[8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-9-[(4-methylsulfonylphenyl)methoxy]-6-oxopyrano[3,2-b]xanthen-5-yl]oxybut-2-enoate (PubChem CID 162372084) has the molecular formula C38H40O10S and a molecular weight of 688.80 g/mol. Its IUPAC name is ethyl (E)-4-[8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-9-[(4-methylsulfonylphenyl)methoxy]-6-oxopyrano[3,2-b]xanthen-5-yl]oxybut-2-enoate.
| Compound Name | ethyl (E)-4-[8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-9-[(4-methylsulfonylphenyl)methoxy]-6-oxopyrano[3,2-b]xanthen-5-yl]oxybut-2-enoate |
|---|---|
| PubChem CID | 162372084 |
| Molecular Formula | C38H40O10S |
| Molecular Weight | 688.80 g/mol |
| Exact Mass | 688.23 |
| IUPAC Name | ethyl (E)-4-[8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-9-[(4-methylsulfonylphenyl)methoxy]-6-oxopyrano[3,2-b]xanthen-5-yl]oxybut-2-enoate |
| SMILES | CCOC(=O)/C=C/COc1c2c(cc3oc4cc(OCc5ccc(S(C)(=O)=O)cc5)c(OC)c(CC=C(C)C)c4c(=O)c13)OC(C)(C)C=C2 |
| InChI | InChI=1S/C38H40O10S/c1-8-44-32(39)10-9-19-45-37-26-17-18-38(4,5)48-28(26)20-30-34(37)35(40)33-27(16-11-23(2)3)36(43-6)31(21-29(33)47-30)46-22-24-12-14-25(15-13-24)49(7,41)42/h9-15,17-18,20-21H,8,16,19,22H2,1-7H3/b10-9+ |
| InChIKey | GYXUDJQGOGVNOF-MDZDMXLPSA-N |
| XLogP | 7.13 |
| TPSA | 127.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.80 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|