C35H40N2O5 — CID 123712746
4-methoxy-3-(3-methylbut-2-enyl)-N-[8-methyl-2-oxo-7-[3-(2-phenylpropan-2-ylamino)propoxy]chromen-3-yl]benzamide (PubChem CID 123712746) has the molecular formula C35H40N2O5 and a molecular weight of 568.71 g/mol. Its IUPAC name is 4-methoxy-3-(3-methylbut-2-enyl)-N-[8-methyl-2-oxo-7-[3-(2-phenylpropan-2-ylamino)propoxy]chromen-3-yl]benzamide.
| Compound Name | 4-methoxy-3-(3-methylbut-2-enyl)-N-[8-methyl-2-oxo-7-[3-(2-phenylpropan-2-ylamino)propoxy]chromen-3-yl]benzamide |
|---|---|
| PubChem CID | 123712746 |
| Molecular Formula | C35H40N2O5 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | 4-methoxy-3-(3-methylbut-2-enyl)-N-[8-methyl-2-oxo-7-[3-(2-phenylpropan-2-ylamino)propoxy]chromen-3-yl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cc3ccc(OCCCNC(C)(C)c4ccccc4)c(C)c3oc2=O)cc1CC=C(C)C |
| InChI | InChI=1S/C35H40N2O5/c1-23(2)13-14-25-21-27(16-18-31(25)40-6)33(38)37-29-22-26-15-17-30(24(3)32(26)42-34(29)39)41-20-10-19-36-35(4,5)28-11-8-7-9-12-28/h7-9,11-13,15-18,21-22,36H,10,14,19-20H2,1-6H3,(H,37,38) |
| InChIKey | LKWODNOBMPIXBY-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|