C29H27NO6 — CID 57399318
4-hydroxy-N-[7-(3-methoxyphenoxy)-8-methyl-2-oxochromen-3-yl]-3-(3-methylbut-2-enyl)benzamide (PubChem CID 57399318) has the molecular formula C29H27NO6 and a molecular weight of 485.54 g/mol. Its IUPAC name is 4-hydroxy-N-[7-(3-methoxyphenoxy)-8-methyl-2-oxochromen-3-yl]-3-(3-methylbut-2-enyl)benzamide.
| Compound Name | 4-hydroxy-N-[7-(3-methoxyphenoxy)-8-methyl-2-oxochromen-3-yl]-3-(3-methylbut-2-enyl)benzamide |
|---|---|
| PubChem CID | 57399318 |
| Molecular Formula | C29H27NO6 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 4-hydroxy-N-[7-(3-methoxyphenoxy)-8-methyl-2-oxochromen-3-yl]-3-(3-methylbut-2-enyl)benzamide |
| SMILES | COc1cccc(Oc2ccc3cc(NC(=O)c4ccc(O)c(CC=C(C)C)c4)c(=O)oc3c2C)c1 |
| InChI | InChI=1S/C29H27NO6/c1-17(2)8-9-19-14-21(10-12-25(19)31)28(32)30-24-15-20-11-13-26(18(3)27(20)36-29(24)33)35-23-7-5-6-22(16-23)34-4/h5-8,10-16,31H,9H2,1-4H3,(H,30,32) |
| InChIKey | KZRCZNUDFAIESG-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|