C32H27NO8S — CID 56680247
[3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-8-methyl-2-oxochromen-7-yl] 4-methylbenzenesulfonate (PubChem CID 56680247) has the molecular formula C32H27NO8S and a molecular weight of 585.63 g/mol. Its IUPAC name is [3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-8-methyl-2-oxochromen-7-yl] 4-methylbenzenesulfonate.
| Compound Name | [3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-8-methyl-2-oxochromen-7-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 56680247 |
| Molecular Formula | C32H27NO8S |
| Molecular Weight | 585.63 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | [3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-8-methyl-2-oxochromen-7-yl] 4-methylbenzenesulfonate |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3cc4ccc(OS(=O)(=O)c5ccc(C)cc5)c(C)c4oc3=O)ccc2OC)c1 |
| InChI | InChI=1S/C32H27NO8S/c1-19-8-12-25(13-9-19)42(36,37)41-28-14-10-22-18-27(32(35)40-30(22)20(28)2)33-31(34)23-11-15-29(39-4)26(17-23)21-6-5-7-24(16-21)38-3/h5-18H,1-4H3,(H,33,34) |
| InChIKey | ZMSMQBXTPQZLIU-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.63 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|