C32H27NO9S — CID 53260574
[8-methoxy-3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-2-oxochromen-7-yl] 4-methylbenzenesulfonate (PubChem CID 53260574) has the molecular formula C32H27NO9S and a molecular weight of 601.63 g/mol. Its IUPAC name is [8-methoxy-3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-2-oxochromen-7-yl] 4-methylbenzenesulfonate.
| Compound Name | [8-methoxy-3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-2-oxochromen-7-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 53260574 |
| Molecular Formula | C32H27NO9S |
| Molecular Weight | 601.63 g/mol |
| Exact Mass | 601.14 |
| IUPAC Name | [8-methoxy-3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-2-oxochromen-7-yl] 4-methylbenzenesulfonate |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3cc4ccc(OS(=O)(=O)c5ccc(C)cc5)c(OC)c4oc3=O)ccc2OC)c1 |
| InChI | InChI=1S/C32H27NO9S/c1-19-8-12-24(13-9-19)43(36,37)42-28-15-10-21-18-26(32(35)41-29(21)30(28)40-4)33-31(34)22-11-14-27(39-3)25(17-22)20-6-5-7-23(16-20)38-2/h5-18H,1-4H3,(H,33,34) |
| InChIKey | WOTPMEWSSFTOGB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 130.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|