C33H33NO7 — CID 53260571
4-methoxy-N-[6-methoxy-8-methyl-7-(5-methylcyclohex-2-en-1-yl)oxy-2-oxochromen-3-yl]-3-(3-methoxyphenyl)benzamide (PubChem CID 53260571) has the molecular formula C33H33NO7 and a molecular weight of 555.63 g/mol. Its IUPAC name is 4-methoxy-N-[6-methoxy-8-methyl-7-(5-methylcyclohex-2-en-1-yl)oxy-2-oxochromen-3-yl]-3-(3-methoxyphenyl)benzamide.
| Compound Name | 4-methoxy-N-[6-methoxy-8-methyl-7-(5-methylcyclohex-2-en-1-yl)oxy-2-oxochromen-3-yl]-3-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 53260571 |
| Molecular Formula | C33H33NO7 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 4-methoxy-N-[6-methoxy-8-methyl-7-(5-methylcyclohex-2-en-1-yl)oxy-2-oxochromen-3-yl]-3-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3cc4cc(OC)c(OC5C=CCC(C)C5)c(C)c4oc3=O)ccc2OC)c1 |
| InChI | InChI=1S/C33H33NO7/c1-19-8-6-11-25(14-19)40-31-20(2)30-23(18-29(31)39-5)17-27(33(36)41-30)34-32(35)22-12-13-28(38-4)26(16-22)21-9-7-10-24(15-21)37-3/h6-7,9-13,15-19,25H,8,14H2,1-5H3,(H,34,35) |
| InChIKey | ZFGJHALQAYXZSI-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|