C27H26NO9P — CID 53260417
[3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-8-methyl-2-oxochromen-7-yl] dimethyl phosphate (PubChem CID 53260417) has the molecular formula C27H26NO9P and a molecular weight of 539.48 g/mol. Its IUPAC name is [3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-8-methyl-2-oxochromen-7-yl] dimethyl phosphate.
| Compound Name | [3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-8-methyl-2-oxochromen-7-yl] dimethyl phosphate |
|---|---|
| PubChem CID | 53260417 |
| Molecular Formula | C27H26NO9P |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | [3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-8-methyl-2-oxochromen-7-yl] dimethyl phosphate |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3cc4ccc(OP(=O)(OC)OC)c(C)c4oc3=O)ccc2OC)c1 |
| InChI | InChI=1S/C27H26NO9P/c1-16-23(37-38(31,34-4)35-5)11-9-18-15-22(27(30)36-25(16)18)28-26(29)19-10-12-24(33-3)21(14-19)17-7-6-8-20(13-17)32-2/h6-15H,1-5H3,(H,28,29) |
| InChIKey | NDBPGTIFEGCTNM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 122.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|