C31H36N2O6 — CID 118063720
[2-(3-methylbut-2-enyl)-4-[[8-methyl-7-[2-(1-methylpyrrolidin-2-yl)ethoxy]-2-oxochromen-3-yl]carbamoyl]phenyl] acetate (PubChem CID 118063720) has the molecular formula C31H36N2O6 and a molecular weight of 532.64 g/mol. Its IUPAC name is [2-(3-methylbut-2-enyl)-4-[[8-methyl-7-[2-(1-methylpyrrolidin-2-yl)ethoxy]-2-oxochromen-3-yl]carbamoyl]phenyl] acetate.
| Compound Name | [2-(3-methylbut-2-enyl)-4-[[8-methyl-7-[2-(1-methylpyrrolidin-2-yl)ethoxy]-2-oxochromen-3-yl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 118063720 |
| Molecular Formula | C31H36N2O6 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | [2-(3-methylbut-2-enyl)-4-[[8-methyl-7-[2-(1-methylpyrrolidin-2-yl)ethoxy]-2-oxochromen-3-yl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)Nc2cc3ccc(OCCC4CCCN4C)c(C)c3oc2=O)cc1CC=C(C)C |
| InChI | InChI=1S/C31H36N2O6/c1-19(2)8-9-22-17-24(11-13-28(22)38-21(4)34)30(35)32-26-18-23-10-12-27(20(3)29(23)39-31(26)36)37-16-14-25-7-6-15-33(25)5/h8,10-13,17-18,25H,6-7,9,14-16H2,1-5H3,(H,32,35) |
| InChIKey | JMLRZVZXQYDPBR-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|