C30H37NO5 — CID 162237167
3-[2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-2-oxoethyl]-8-methyl-7-[3-(2-methylpropylamino)propoxy]chromen-2-one (PubChem CID 162237167) has the molecular formula C30H37NO5 and a molecular weight of 491.63 g/mol. Its IUPAC name is 3-[2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-2-oxoethyl]-8-methyl-7-[3-(2-methylpropylamino)propoxy]chromen-2-one.
| Compound Name | 3-[2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-2-oxoethyl]-8-methyl-7-[3-(2-methylpropylamino)propoxy]chromen-2-one |
|---|---|
| PubChem CID | 162237167 |
| Molecular Formula | C30H37NO5 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | 3-[2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-2-oxoethyl]-8-methyl-7-[3-(2-methylpropylamino)propoxy]chromen-2-one |
| SMILES | CC(C)=CCc1cc(C(=O)Cc2cc3ccc(OCCCNCC(C)C)c(C)c3oc2=O)ccc1O |
| InChI | InChI=1S/C30H37NO5/c1-19(2)7-8-22-15-23(9-11-26(22)32)27(33)17-25-16-24-10-12-28(21(5)29(24)36-30(25)34)35-14-6-13-31-18-20(3)4/h7,9-12,15-16,20,31-32H,6,8,13-14,17-18H2,1-5H3 |
| InChIKey | ZWFFMMWBICYITH-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|