C23H31NO4 — CID 149404995
3-(4,4-dimethyl-2-oxopentyl)-8-methyl-7-(1-methylpiperidin-4-yl)oxychromen-2-one (PubChem CID 149404995) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is 3-(4,4-dimethyl-2-oxopentyl)-8-methyl-7-(1-methylpiperidin-4-yl)oxychromen-2-one.
| Compound Name | 3-(4,4-dimethyl-2-oxopentyl)-8-methyl-7-(1-methylpiperidin-4-yl)oxychromen-2-one |
|---|---|
| PubChem CID | 149404995 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 3-(4,4-dimethyl-2-oxopentyl)-8-methyl-7-(1-methylpiperidin-4-yl)oxychromen-2-one |
| SMILES | Cc1c(OC2CCN(C)CC2)ccc2cc(CC(=O)CC(C)(C)C)c(=O)oc12 |
| InChI | InChI=1S/C23H31NO4/c1-15-20(27-19-8-10-24(5)11-9-19)7-6-16-12-17(22(26)28-21(15)16)13-18(25)14-23(2,3)4/h6-7,12,19H,8-11,13-14H2,1-5H3 |
| InChIKey | YQCQSQGWHMYZPN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|